C15H26O2 — CID 134861453
(2R)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-4,4-dimethylhex-5-en-3-ol (PubChem CID 134861453) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2R)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-4,4-dimethylhex-5-en-3-ol.
| Compound Name | (2R)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-4,4-dimethylhex-5-en-3-ol |
|---|---|
| PubChem CID | 134861453 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2R)-2-[(2S,5R)-5-ethenyl-5-methyloxolan-2-yl]-4,4-dimethylhex-5-en-3-ol |
| SMILES | C=CC(C)(C)C(O)[C@@H](C)[C@@H]1CC[C@](C)(C=C)O1 |
| InChI | InChI=1S/C15H26O2/c1-7-14(4,5)13(16)11(3)12-9-10-15(6,8-2)17-12/h7-8,11-13,16H,1-2,9-10H2,3-6H3/t11-,12-,13?,15-/m0/s1 |
| InChIKey | MKTVDMJRBCBNPW-VKXBSSMUSA-N |
| XLogP | 3.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|