About methylsulfanylmethyl hex-5-enoate
methylsulfanylmethyl hex-5-enoate (PubChem CID 134861480) has the molecular formula C8H14O2S
and a molecular weight of 174.26 g/mol. Its IUPAC name is methylsulfanylmethyl hex-5-enoate.
Molecular Properties
| Compound Name | methylsulfanylmethyl hex-5-enoate |
| PubChem CID | 134861480 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | methylsulfanylmethyl hex-5-enoate |
| SMILES | C=CCCCC(=O)OCSC |
| InChI | InChI=1S/C8H14O2S/c1-3-4-5-6-8(9)10-7-11-2/h3H,1,4-7H2,2H3 |
| InChIKey | TUAFLXNOAOMDJV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methylsulfanylmethyl hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfanylmethyl hex-5-enoate?
The IUPAC name of methylsulfanylmethyl hex-5-enoate (CID 134861480) is methylsulfanylmethyl hex-5-enoate.
What is the SMILES notation for methylsulfanylmethyl hex-5-enoate?
The canonical SMILES for methylsulfanylmethyl hex-5-enoate is C=CCCCC(=O)OCSC.
What is the InChIKey of methylsulfanylmethyl hex-5-enoate?
The InChIKey is TUAFLXNOAOMDJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2S/c1-3-4-5-6-8(9)10-7-11-2/h3H,1,4-7H2,2H3.
What are the key properties of methylsulfanylmethyl hex-5-enoate?
methylsulfanylmethyl hex-5-enoate has a molecular weight of 174.26 g/mol, XLogP of 2.21, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfanylmethyl hex-5-enoate is sourced from PubChem (CID 134861480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).