About (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine
(E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine (PubChem CID 134861587) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine.
Molecular Properties
| Compound Name | (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine |
| PubChem CID | 134861587 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine |
| SMILES | CC=CO/N=C1\CCc2cc(OC)ccc21 |
| InChI | InChI=1S/C13H15NO2/c1-3-8-16-14-13-7-4-10-9-11(15-2)5-6-12(10)13/h3,5-6,8-9H,4,7H2,1-2H3/b8-3?,14-13+ |
| InChIKey | XBKRCDRRJMJBHS-GQJBSQIPSA-N |
| XLogP | 2.90 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine?
The IUPAC name of (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine (CID 134861587) is (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine.
What is the SMILES notation for (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine?
The canonical SMILES for (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine is CC=CO/N=C1\CCc2cc(OC)ccc21.
What is the InChIKey of (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine?
The InChIKey is XBKRCDRRJMJBHS-GQJBSQIPSA-N. The full InChI is InChI=1S/C13H15NO2/c1-3-8-16-14-13-7-4-10-9-11(15-2)5-6-12(10)13/h3,5-6,8-9H,4,7H2,1-2H3/b8-3?,14-13+.
What are the key properties of (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine?
(E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine has a molecular weight of 217.27 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-methoxy-N-prop-1-enoxy-2,3-dihydroinden-1-imine is sourced from PubChem (CID 134861587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).