C13H18FNO2 — CID 134861765
(2S,3S)-2-ethyl-3-(4-fluorophenyl)-4-methylmorpholin-2-ol (PubChem CID 134861765) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is (2S,3S)-2-ethyl-3-(4-fluorophenyl)-4-methylmorpholin-2-ol.
| Compound Name | (2S,3S)-2-ethyl-3-(4-fluorophenyl)-4-methylmorpholin-2-ol |
|---|---|
| PubChem CID | 134861765 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (2S,3S)-2-ethyl-3-(4-fluorophenyl)-4-methylmorpholin-2-ol |
| SMILES | CC[C@]1(O)OCCN(C)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO2/c1-3-13(16)12(15(2)8-9-17-13)10-4-6-11(14)7-5-10/h4-7,12,16H,3,8-9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | PEYSUXDCVYIIMV-STQMWFEESA-N |
| XLogP | 1.93 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |