C16H19F3O — CID 134861811
(2S,5Z,8S)-2,6-dimethyl-8-[4-(trifluoromethyl)phenyl]-3,4,7,8-tetrahydro-2H-oxocine (PubChem CID 134861811) has the molecular formula C16H19F3O and a molecular weight of 284.32 g/mol. Its IUPAC name is (2S,5Z,8S)-2,6-dimethyl-8-[4-(trifluoromethyl)phenyl]-3,4,7,8-tetrahydro-2H-oxocine.
| Compound Name | (2S,5Z,8S)-2,6-dimethyl-8-[4-(trifluoromethyl)phenyl]-3,4,7,8-tetrahydro-2H-oxocine |
|---|---|
| PubChem CID | 134861811 |
| Molecular Formula | C16H19F3O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (2S,5Z,8S)-2,6-dimethyl-8-[4-(trifluoromethyl)phenyl]-3,4,7,8-tetrahydro-2H-oxocine |
| SMILES | C/C1=C/CC[C@H](C)O[C@H](c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H19F3O/c1-11-4-3-5-12(2)20-15(10-11)13-6-8-14(9-7-13)16(17,18)19/h4,6-9,12,15H,3,5,10H2,1-2H3/b11-4-/t12-,15-/m0/s1 |
| InChIKey | PBMWVOJEUILROF-GCUGINILSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|