C15H15FO3S — CID 134861884
1-(benzenesulfonyl)-2-(4-fluorophenyl)propan-2-ol (PubChem CID 134861884) has the molecular formula C15H15FO3S and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-(4-fluorophenyl)propan-2-ol.
| Compound Name | 1-(benzenesulfonyl)-2-(4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 134861884 |
| Molecular Formula | C15H15FO3S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-(benzenesulfonyl)-2-(4-fluorophenyl)propan-2-ol |
| SMILES | CC(O)(CS(=O)(=O)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H15FO3S/c1-15(17,12-7-9-13(16)10-8-12)11-20(18,19)14-5-3-2-4-6-14/h2-10,17H,11H2,1H3 |
| InChIKey | CGYCXTFFFUJOMF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |