C15H32OSi2 — CID 134861965
tert-butyl-dimethyl-[(1R,2E,3R)-3-methyl-2-(trimethylsilylmethylidene)cyclobutyl]oxysilane (PubChem CID 134861965) has the molecular formula C15H32OSi2 and a molecular weight of 284.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2E,3R)-3-methyl-2-(trimethylsilylmethylidene)cyclobutyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,2E,3R)-3-methyl-2-(trimethylsilylmethylidene)cyclobutyl]oxysilane |
|---|---|
| PubChem CID | 134861965 |
| Molecular Formula | C15H32OSi2 |
| Molecular Weight | 284.59 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2E,3R)-3-methyl-2-(trimethylsilylmethylidene)cyclobutyl]oxysilane |
| SMILES | C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)/C1=C/[Si](C)(C)C |
| InChI | InChI=1S/C15H32OSi2/c1-12-10-14(13(12)11-17(5,6)7)16-18(8,9)15(2,3)4/h11-12,14H,10H2,1-9H3/b13-11+/t12-,14-/m1/s1 |
| InChIKey | HKIMSVFVSRRAKN-ZSPDEYSBSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|