C14H16F3N — CID 134862015
1-[(E,2R)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]pyrrolidine (PubChem CID 134862015) has the molecular formula C14H16F3N and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-[(E,2R)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]pyrrolidine.
| Compound Name | 1-[(E,2R)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]pyrrolidine |
|---|---|
| PubChem CID | 134862015 |
| Molecular Formula | C14H16F3N |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-[(E,2R)-1,1,1-trifluoro-4-phenylbut-3-en-2-yl]pyrrolidine |
| SMILES | FC(F)(F)[C@@H](/C=C/c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C14H16F3N/c15-14(16,17)13(18-10-4-5-11-18)9-8-12-6-2-1-3-7-12/h1-3,6-9,13H,4-5,10-11H2/b9-8+/t13-/m1/s1 |
| InChIKey | PKORTDUXOUOQLA-MMQHEFTJSA-N |
| XLogP | 3.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |