About [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane
[(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane (PubChem CID 134862038) has the molecular formula C11H24OSi
and a molecular weight of 200.40 g/mol. Its IUPAC name is [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane.
Molecular Properties
| Compound Name | [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane |
| PubChem CID | 134862038 |
| Molecular Formula | C11H24OSi |
| Molecular Weight | 200.40 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane |
| SMILES | CCC/C=C\[C@@H](C)OC[Si](C)(C)C |
| InChI | InChI=1S/C11H24OSi/c1-6-7-8-9-11(2)12-10-13(3,4)5/h8-9,11H,6-7,10H2,1-5H3/b9-8-/t11-/m1/s1 |
| InChIKey | POGNRTCXDCANQT-TYBABMIJSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane?
The IUPAC name of [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane (CID 134862038) is [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane.
What is the SMILES notation for [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane?
The canonical SMILES for [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane is CCC/C=C\[C@@H](C)OC[Si](C)(C)C.
What is the InChIKey of [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane?
The InChIKey is POGNRTCXDCANQT-TYBABMIJSA-N. The full InChI is InChI=1S/C11H24OSi/c1-6-7-8-9-11(2)12-10-13(3,4)5/h8-9,11H,6-7,10H2,1-5H3/b9-8-/t11-/m1/s1.
What are the key properties of [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane?
[(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane has a molecular weight of 200.40 g/mol, XLogP of 3.63, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,2R)-hept-3-en-2-yl]oxymethyl-trimethylsilane is sourced from PubChem (CID 134862038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).