C13H24O5 — CID 134862081
(E,4R,5R)-7-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-6-ene-1,4,5-triol (PubChem CID 134862081) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is (E,4R,5R)-7-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-6-ene-1,4,5-triol.
| Compound Name | (E,4R,5R)-7-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-6-ene-1,4,5-triol |
|---|---|
| PubChem CID | 134862081 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (E,4R,5R)-7-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hept-6-ene-1,4,5-triol |
| SMILES | C[C@@H]1OC(C)(C)O[C@@H]1/C=C/[C@@H](O)[C@H](O)CCCO |
| InChI | InChI=1S/C13H24O5/c1-9-12(18-13(2,3)17-9)7-6-11(16)10(15)5-4-8-14/h6-7,9-12,14-16H,4-5,8H2,1-3H3/b7-6+/t9-,10+,11+,12+/m0/s1 |
| InChIKey | IVCJAMFYKLKMCZ-JCEZYFILSA-N |
| XLogP | 0.58 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|