About ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate
ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate (PubChem CID 134862110) has the molecular formula C11H18O6
and a molecular weight of 246.26 g/mol. Its IUPAC name is ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate |
| PubChem CID | 134862110 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate |
| SMILES | CCOC(=O)C(C)(O)C(=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H18O6/c1-5-15-9(13)11(4,14)8(12)7-6-16-10(2,3)17-7/h7,14H,5-6H2,1-4H3/t7-,11?/m1/s1 |
| InChIKey | GWUICMOVHHDMAI-DKSCNQEISA-N |
| XLogP | 0.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate?
The IUPAC name of ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate (CID 134862110) is ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate.
What is the SMILES notation for ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate?
The canonical SMILES for ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate is CCOC(=O)C(C)(O)C(=O)[C@H]1COC(C)(C)O1.
What is the InChIKey of ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate?
The InChIKey is GWUICMOVHHDMAI-DKSCNQEISA-N. The full InChI is InChI=1S/C11H18O6/c1-5-15-9(13)11(4,14)8(12)7-6-16-10(2,3)17-7/h7,14H,5-6H2,1-4H3/t7-,11?/m1/s1.
What are the key properties of ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate?
ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate has a molecular weight of 246.26 g/mol, XLogP of 0.02, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxy-2-methyl-3-oxopropanoate is sourced from PubChem (CID 134862110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).