C8H13N — CID 134862195
(2S)-2-ethenyl-6-methyl-2,3,4,5-tetrahydropyridine (PubChem CID 134862195) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is (2S)-2-ethenyl-6-methyl-2,3,4,5-tetrahydropyridine.
| Compound Name | (2S)-2-ethenyl-6-methyl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 134862195 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | (2S)-2-ethenyl-6-methyl-2,3,4,5-tetrahydropyridine |
| SMILES | C=C[C@@H]1CCCC(C)=N1 |
| InChI | InChI=1S/C8H13N/c1-3-8-6-4-5-7(2)9-8/h3,8H,1,4-6H2,2H3/t8-/m1/s1 |
| InChIKey | SUWJQCJPSSEYMH-MRVPVSSYSA-N |
| XLogP | 2.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|