C11H11ORf- — CID 134862260
8-ethenyl-2,3,4,6-tetrahydrochromen-6-ide;rutherfordium (PubChem CID 134862260) has the molecular formula C11H11ORf- and a molecular weight of 426.21 g/mol. Its IUPAC name is 8-ethenyl-2,3,4,6-tetrahydrochromen-6-ide;rutherfordium.
| Compound Name | 8-ethenyl-2,3,4,6-tetrahydrochromen-6-ide;rutherfordium |
|---|---|
| PubChem CID | 134862260 |
| Molecular Formula | C11H11ORf- |
| Molecular Weight | 426.21 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 8-ethenyl-2,3,4,6-tetrahydrochromen-6-ide;rutherfordium |
| SMILES | C=Cc1c[c-]cc2c1OCCC2.[Rf] |
| InChI | InChI=1S/C11H11O.Rf/c1-2-9-5-3-6-10-7-4-8-12-11(9)10;/h2,5-6H,1,4,7-8H2;/q-1; |
| InChIKey | SMUMEIFGIUSOSJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.21 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|