C12H11BrF2N2 — CID 134862272
3-(4-bromophenyl)-5-(1,1-difluoroethyl)-1-methylpyrazole (PubChem CID 134862272) has the molecular formula C12H11BrF2N2 and a molecular weight of 301.13 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-(1,1-difluoroethyl)-1-methylpyrazole.
| Compound Name | 3-(4-bromophenyl)-5-(1,1-difluoroethyl)-1-methylpyrazole |
|---|---|
| PubChem CID | 134862272 |
| Molecular Formula | C12H11BrF2N2 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 3-(4-bromophenyl)-5-(1,1-difluoroethyl)-1-methylpyrazole |
| SMILES | Cn1nc(-c2ccc(Br)cc2)cc1C(C)(F)F |
| InChI | InChI=1S/C12H11BrF2N2/c1-12(14,15)11-7-10(16-17(11)2)8-3-5-9(13)6-4-8/h3-7H,1-2H3 |
| InChIKey | YSFIOEYFWAXTLT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |