About 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol
2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol (PubChem CID 134862840) has the molecular formula C9H19N2O+
and a molecular weight of 171.26 g/mol. Its IUPAC name is 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol |
| PubChem CID | 134862840 |
| Molecular Formula | C9H19N2O+ |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol |
| SMILES | CC(C)(C)N1C=[N+](CCO)CC1 |
| InChI | InChI=1S/C9H19N2O/c1-9(2,3)11-5-4-10(8-11)6-7-12/h8,12H,4-7H2,1-3H3/q+1 |
| InChIKey | SVJVMOCRZQYHPK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol?
The IUPAC name of 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol (CID 134862840) is 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol.
What is the SMILES notation for 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol?
The canonical SMILES for 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol is CC(C)(C)N1C=[N+](CCO)CC1.
What is the InChIKey of 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol?
The InChIKey is SVJVMOCRZQYHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N2O/c1-9(2,3)11-5-4-10(8-11)6-7-12/h8,12H,4-7H2,1-3H3/q+1.
What are the key properties of 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol?
2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol has a molecular weight of 171.26 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-tert-butyl-4,5-dihydroimidazol-1-ium-1-yl)ethanol is sourced from PubChem (CID 134862840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).