About CID 134862886
CID 134862886 (PubChem CID 134862886) has the molecular formula C9H9NOY-2
and a molecular weight of 236.08 g/mol.
Molecular Properties
| Compound Name | CID 134862886 |
| PubChem CID | 134862886 |
| Molecular Formula | C9H9NOY-2 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 235.98 |
| IUPAC Name | — |
| SMILES | [H]/[C-]=C/C1=[C-]/C/C=C\CNC1=O.[Y] |
| InChI | InChI=1S/C9H9NO.Y/c1-2-8-6-4-3-5-7-10-9(8)11;/h1-3,5H,4,7H2,(H,10,11);/q-2;/b5-3-; |
| InChIKey | HAFIOQJMDATAEA-FBZPGIPVSA-N |
| XLogP | 0.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 134862886 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134862886?
The IUPAC name of CID 134862886 (CID 134862886) is not available.
What is the SMILES notation for CID 134862886?
The canonical SMILES for CID 134862886 is [H]/[C-]=C/C1=[C-]/C/C=C\CNC1=O.[Y].
What is the InChIKey of CID 134862886?
The InChIKey is HAFIOQJMDATAEA-FBZPGIPVSA-N. The full InChI is InChI=1S/C9H9NO.Y/c1-2-8-6-4-3-5-7-10-9(8)11;/h1-3,5H,4,7H2,(H,10,11);/q-2;/b5-3-;.
What are the key properties of CID 134862886?
CID 134862886 has a molecular weight of 236.08 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134862886 is sourced from PubChem (CID 134862886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).