C12H11Br2NO4 — CID 134862911
3-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 134862911) has the molecular formula C12H11Br2NO4 and a molecular weight of 393.03 g/mol. Its IUPAC name is 3-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134862911 |
| Molecular Formula | C12H11Br2NO4 |
| Molecular Weight | 393.03 g/mol |
| Exact Mass | 390.91 |
| IUPAC Name | 3-[(2,3-dibromo-4-hydroxy-5-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1cc(CC2CC(=O)NC2=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C12H11Br2NO4/c1-19-7-3-5(9(13)10(14)11(7)17)2-6-4-8(16)15-12(6)18/h3,6,17H,2,4H2,1H3,(H,15,16,18) |
| InChIKey | PZPNGWAGNVDYES-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.03 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|