C18H25FO — CID 134863101
(3R,4R,5E)-2-fluoro-3-(2-phenylethyl)deca-1,5-dien-4-ol (PubChem CID 134863101) has the molecular formula C18H25FO and a molecular weight of 276.39 g/mol. Its IUPAC name is (3R,4R,5E)-2-fluoro-3-(2-phenylethyl)deca-1,5-dien-4-ol.
| Compound Name | (3R,4R,5E)-2-fluoro-3-(2-phenylethyl)deca-1,5-dien-4-ol |
|---|---|
| PubChem CID | 134863101 |
| Molecular Formula | C18H25FO |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | (3R,4R,5E)-2-fluoro-3-(2-phenylethyl)deca-1,5-dien-4-ol |
| SMILES | C=C(F)C(CCc1ccccc1)[C@H](O)/C=C/CCCC |
| InChI | InChI=1S/C18H25FO/c1-3-4-5-9-12-18(20)17(15(2)19)14-13-16-10-7-6-8-11-16/h6-12,17-18,20H,2-5,13-14H2,1H3/b12-9+/t17?,18-/m1/s1 |
| InChIKey | WVBQKRCHNHLZBR-XZRALTFJSA-N |
| XLogP | 4.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|