C17H26O2Si — CID 134863157
ethyl 3-[dimethyl(phenyl)silyl]-2,4-dimethylpent-3-enoate (PubChem CID 134863157) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is ethyl 3-[dimethyl(phenyl)silyl]-2,4-dimethylpent-3-enoate.
| Compound Name | ethyl 3-[dimethyl(phenyl)silyl]-2,4-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 134863157 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | ethyl 3-[dimethyl(phenyl)silyl]-2,4-dimethylpent-3-enoate |
| SMILES | CCOC(=O)C(C)C(=C(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H26O2Si/c1-7-19-17(18)14(4)16(13(2)3)20(5,6)15-11-9-8-10-12-15/h8-12,14H,7H2,1-6H3 |
| InChIKey | SWRZLJADJQFDQN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|