C14H9F2NO — CID 134863233
1,4-difluoro-5-methoxyacridine (PubChem CID 134863233) has the molecular formula C14H9F2NO and a molecular weight of 245.23 g/mol. Its IUPAC name is 1,4-difluoro-5-methoxyacridine.
| Compound Name | 1,4-difluoro-5-methoxyacridine |
|---|---|
| PubChem CID | 134863233 |
| Molecular Formula | C14H9F2NO |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1,4-difluoro-5-methoxyacridine |
| SMILES | COc1cccc2cc3c(F)ccc(F)c3nc12 |
| InChI | InChI=1S/C14H9F2NO/c1-18-12-4-2-3-8-7-9-10(15)5-6-11(16)14(9)17-13(8)12/h2-7H,1H3 |
| InChIKey | MRKQWRUJFZYLBI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|