C16H16N2 — CID 134863300
2-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydroquinoxaline (PubChem CID 134863300) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 2-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 134863300 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]-1,2,3,4-tetrahydroquinoxaline |
| SMILES | C(=C/C1CNc2ccccc2N1)\c1ccccc1 |
| InChI | InChI=1S/C16H16N2/c1-2-6-13(7-3-1)10-11-14-12-17-15-8-4-5-9-16(15)18-14/h1-11,14,17-18H,12H2/b11-10+ |
| InChIKey | LDMYLKYKMVSFGA-ZHACJKMWSA-N |
| XLogP | 3.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|