About 4-deuteriooxyhepta-1,6-diene
4-deuteriooxyhepta-1,6-diene (PubChem CID 134863552) has the molecular formula C7H12O
and a molecular weight of 113.18 g/mol. Its IUPAC name is 4-deuteriooxyhepta-1,6-diene.
Molecular Properties
| Compound Name | 4-deuteriooxyhepta-1,6-diene |
| PubChem CID | 134863552 |
| Molecular Formula | C7H12O |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 4-deuteriooxyhepta-1,6-diene |
| SMILES | [2H]OC(CC=C)CC=C |
| InChI | InChI=1S/C7H12O/c1-3-5-7(8)6-4-2/h3-4,7-8H,1-2,5-6H2/i8D |
| InChIKey | UTGFOWQYZKTZTN-BNEYPBHNSA-N |
| XLogP | 1.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-deuteriooxyhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-deuteriooxyhepta-1,6-diene?
The IUPAC name of 4-deuteriooxyhepta-1,6-diene (CID 134863552) is 4-deuteriooxyhepta-1,6-diene.
What is the SMILES notation for 4-deuteriooxyhepta-1,6-diene?
The canonical SMILES for 4-deuteriooxyhepta-1,6-diene is [2H]OC(CC=C)CC=C.
What is the InChIKey of 4-deuteriooxyhepta-1,6-diene?
The InChIKey is UTGFOWQYZKTZTN-BNEYPBHNSA-N. The full InChI is InChI=1S/C7H12O/c1-3-5-7(8)6-4-2/h3-4,7-8H,1-2,5-6H2/i8D.
What are the key properties of 4-deuteriooxyhepta-1,6-diene?
4-deuteriooxyhepta-1,6-diene has a molecular weight of 113.18 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-deuteriooxyhepta-1,6-diene is sourced from PubChem (CID 134863552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).