C25H52O3Si2 — CID 134863670
(E,2R,6S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyhept-4-en-3-one (PubChem CID 134863670) has the molecular formula C25H52O3Si2 and a molecular weight of 456.86 g/mol. Its IUPAC name is (E,2R,6S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyhept-4-en-3-one.
| Compound Name | (E,2R,6S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyhept-4-en-3-one |
|---|---|
| PubChem CID | 134863670 |
| Molecular Formula | C25H52O3Si2 |
| Molecular Weight | 456.86 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | (E,2R,6S)-1-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyhept-4-en-3-one |
| SMILES | C/C(=C\[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)C(=O)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O3Si2/c1-18(2)30(19(3)4,20(5)6)28-16-21(7)15-22(8)24(26)23(9)17-27-29(13,14)25(10,11)12/h15,18-21,23H,16-17H2,1-14H3/b22-15+/t21-,23+/m0/s1 |
| InChIKey | PWTZDWAAZKQUMV-FNCSVQCMSA-N |
| XLogP | 7.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.86 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|