C19H40O3Si — CID 134863671
(E,2R,3S,6S)-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyhept-4-ene-1,3-diol (PubChem CID 134863671) has the molecular formula C19H40O3Si and a molecular weight of 344.61 g/mol. Its IUPAC name is (E,2R,3S,6S)-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyhept-4-ene-1,3-diol.
| Compound Name | (E,2R,3S,6S)-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyhept-4-ene-1,3-diol |
|---|---|
| PubChem CID | 134863671 |
| Molecular Formula | C19H40O3Si |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (E,2R,3S,6S)-2,4,6-trimethyl-7-tri(propan-2-yl)silyloxyhept-4-ene-1,3-diol |
| SMILES | C/C(=C\[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O)[C@H](C)CO |
| InChI | InChI=1S/C19H40O3Si/c1-13(2)23(14(3)4,15(5)6)22-12-16(7)10-17(8)19(21)18(9)11-20/h10,13-16,18-21H,11-12H2,1-9H3/b17-10+/t16-,18+,19+/m0/s1 |
| InChIKey | RUAGTLWQRKTMKO-RRCVEZJGSA-N |
| XLogP | 4.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|