C13H20O6 — CID 134863978
(1R,2R,6R,8S)-10-(hydroxymethyl)-4,4-dimethyl-3,5,7,14-tetraoxatricyclo[6.6.0.02,6]tetradecan-9-one (PubChem CID 134863978) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (1R,2R,6R,8S)-10-(hydroxymethyl)-4,4-dimethyl-3,5,7,14-tetraoxatricyclo[6.6.0.02,6]tetradecan-9-one.
| Compound Name | (1R,2R,6R,8S)-10-(hydroxymethyl)-4,4-dimethyl-3,5,7,14-tetraoxatricyclo[6.6.0.02,6]tetradecan-9-one |
|---|---|
| PubChem CID | 134863978 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (1R,2R,6R,8S)-10-(hydroxymethyl)-4,4-dimethyl-3,5,7,14-tetraoxatricyclo[6.6.0.02,6]tetradecan-9-one |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C(=O)C(CO)CCCO[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C13H20O6/c1-13(2)18-11-10-9(17-12(11)19-13)8(15)7(6-14)4-3-5-16-10/h7,9-12,14H,3-6H2,1-2H3/t7?,9-,10+,11-,12-/m1/s1 |
| InChIKey | LCORGNOGIOTAIG-DDRLPIAMSA-N |
| XLogP | 0.22 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |