C17H18F3NO4 — CID 134863986
(3aR,7aR)-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 134863986) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is (3aR,7aR)-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | (3aR,7aR)-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 134863986 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (3aR,7aR)-3-[(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | CO[C@](C(=O)N1C(=O)O[C@@H]2CCCC[C@H]21)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO4/c1-24-16(17(18,19)20,11-7-3-2-4-8-11)14(22)21-12-9-5-6-10-13(12)25-15(21)23/h2-4,7-8,12-13H,5-6,9-10H2,1H3/t12-,13-,16+/m1/s1 |
| InChIKey | RHJRSVHTBAJOHM-IOASZLSFSA-N |
| XLogP | 3.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |