C18H20N2O4 — CID 134864016
(2S,6R,9S)-4,7,7-trimethyl-9-phenyl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione (PubChem CID 134864016) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (2S,6R,9S)-4,7,7-trimethyl-9-phenyl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione.
| Compound Name | (2S,6R,9S)-4,7,7-trimethyl-9-phenyl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione |
|---|---|
| PubChem CID | 134864016 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (2S,6R,9S)-4,7,7-trimethyl-9-phenyl-11-oxa-4,8-diazatricyclo[6.4.0.02,6]dodecane-3,5,12-trione |
| SMILES | CN1C(=O)[C@@H]2C3C(=O)OC[C@H](c4ccccc4)N3C(C)(C)[C@@H]2C1=O |
| InChI | InChI=1S/C18H20N2O4/c1-18(2)13-12(15(21)19(3)16(13)22)14-17(23)24-9-11(20(14)18)10-7-5-4-6-8-10/h4-8,11-14H,9H2,1-3H3/t11-,12+,13+,14?/m1/s1 |
| InChIKey | YLKFJFZZXHMXSS-PYXFJAETSA-N |
| XLogP | 0.98 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|