C39H45NO7 — CID 134864056
ethyl (3S)-3-amino-3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate (PubChem CID 134864056) has the molecular formula C39H45NO7 and a molecular weight of 639.79 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate.
| Compound Name | ethyl (3S)-3-amino-3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 134864056 |
| Molecular Formula | C39H45NO7 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | ethyl (3S)-3-amino-3-[(2R,3S,4R,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propanoate |
| SMILES | CCOC(=O)C[C@H](N)[C@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C39H45NO7/c1-2-43-35(41)23-33(40)36-38(45-26-31-19-11-5-12-20-31)39(46-27-32-21-13-6-14-22-32)37(44-25-30-17-9-4-10-18-30)34(47-36)28-42-24-29-15-7-3-8-16-29/h3-22,33-34,36-39H,2,23-28,40H2,1H3/t33-,34+,36+,37-,38-,39-/m0/s1 |
| InChIKey | HGDVYJWLEZECMC-IFIGLPRISA-N |
| XLogP | 6.01 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |