C20H28O — CID 134864076
cis-(2S,3S)-2-[(E,7S)-4,7-dimethyldec-3-en-9-ynyl]-3-ethynyl-2-methylcyclopentan-1-one (PubChem CID 134864076) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is cis-(2S,3S)-2-[(E,7S)-4,7-dimethyldec-3-en-9-ynyl]-3-ethynyl-2-methylcyclopentan-1-one.
| Compound Name | cis-(2S,3S)-2-[(E,7S)-4,7-dimethyldec-3-en-9-ynyl]-3-ethynyl-2-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 134864076 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | cis-(2S,3S)-2-[(E,7S)-4,7-dimethyldec-3-en-9-ynyl]-3-ethynyl-2-methylcyclopentan-1-one |
| SMILES | C#CC[C@@H](C)CC/C(C)=C/CC[C@]1(C)C(=O)CC[C@H]1C#C |
| InChI | InChI=1S/C20H28O/c1-6-9-16(3)11-12-17(4)10-8-15-20(5)18(7-2)13-14-19(20)21/h1-2,10,16,18H,8-9,11-15H2,3-5H3/b17-10+/t16-,18-,20+/m1/s1 |
| InChIKey | RMBREMZBWRQRSG-QKPHWVQWSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|