C18H19O6- — CID 134864206
(1R,7E,9R,10S,11E)-9,10-diethyl-1-methyl-6,13,15-trioxo-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-3,7,11-trien-4-olate (PubChem CID 134864206) has the molecular formula C18H19O6- and a molecular weight of 331.34 g/mol. Its IUPAC name is (1R,7E,9R,10S,11E)-9,10-diethyl-1-methyl-6,13,15-trioxo-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-3,7,11-trien-4-olate.
| Compound Name | (1R,7E,9R,10S,11E)-9,10-diethyl-1-methyl-6,13,15-trioxo-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-3,7,11-trien-4-olate |
|---|---|
| PubChem CID | 134864206 |
| Molecular Formula | C18H19O6- |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (1R,7E,9R,10S,11E)-9,10-diethyl-1-methyl-6,13,15-trioxo-5,14-dioxatricyclo[10.3.0.03,7]pentadeca-3,7,11-trien-4-olate |
| SMILES | CC[C@H]1/C=C2/C(=O)OC([O-])=C2C[C@@]2(C)C(=O)OC(=O)/C2=C/[C@H]1CC |
| InChI | InChI=1S/C18H20O6/c1-4-9-6-11-12(15(20)23-14(11)19)8-18(3)13(7-10(9)5-2)16(21)24-17(18)22/h6-7,9-10,20H,4-5,8H2,1-3H3/p-1/b11-6+,13-7-/t9-,10+,18+/m0/s1 |
| InChIKey | HEQLMEPVQBQLCH-CRFAHBOBSA-M |
| XLogP | 1.51 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|