C16H26O4 — CID 134864305
(3aR,5S,7aS)-5-(2,2-dimethyl-1,3-dioxan-5-yl)-2,2,7a-trimethyl-4,5-dihydro-3aH-1,3-benzodioxole (PubChem CID 134864305) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (3aR,5S,7aS)-5-(2,2-dimethyl-1,3-dioxan-5-yl)-2,2,7a-trimethyl-4,5-dihydro-3aH-1,3-benzodioxole.
| Compound Name | (3aR,5S,7aS)-5-(2,2-dimethyl-1,3-dioxan-5-yl)-2,2,7a-trimethyl-4,5-dihydro-3aH-1,3-benzodioxole |
|---|---|
| PubChem CID | 134864305 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (3aR,5S,7aS)-5-(2,2-dimethyl-1,3-dioxan-5-yl)-2,2,7a-trimethyl-4,5-dihydro-3aH-1,3-benzodioxole |
| SMILES | CC1(C)OCC([C@@H]2C=C[C@]3(C)OC(C)(C)O[C@@H]3C2)CO1 |
| InChI | InChI=1S/C16H26O4/c1-14(2)17-9-12(10-18-14)11-6-7-16(5)13(8-11)19-15(3,4)20-16/h6-7,11-13H,8-10H2,1-5H3/t11-,13-,16+/m1/s1 |
| InChIKey | AWQGAEMTMLJLOV-KFNAQCHYSA-N |
| XLogP | 2.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|