C18H15I — CID 134864318
5-(2-iodoethynyl)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene (PubChem CID 134864318) has the molecular formula C18H15I and a molecular weight of 358.22 g/mol. Its IUPAC name is 5-(2-iodoethynyl)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene.
| Compound Name | 5-(2-iodoethynyl)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
|---|---|
| PubChem CID | 134864318 |
| Molecular Formula | C18H15I |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 5-(2-iodoethynyl)tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
| SMILES | IC#Cc1cc2ccc1CCc1ccc(cc1)CC2 |
| InChI | InChI=1S/C18H15I/c19-12-11-18-13-16-6-5-14-1-3-15(4-2-14)7-9-17(18)10-8-16/h1-4,8,10,13H,5-7,9H2 |
| InChIKey | GEQKEXLYJFFUBM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|