C22H19N3O3 — CID 134864352
(4R)-3'-benzyl-2-phenylspiro[3a,5,6,6a-tetrahydrocyclopenta[c]pyrrole-4,5'-imidazole]-1,3,4'-trione (PubChem CID 134864352) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is (4R)-3'-benzyl-2-phenylspiro[3a,5,6,6a-tetrahydrocyclopenta[c]pyrrole-4,5'-imidazole]-1,3,4'-trione.
| Compound Name | (4R)-3'-benzyl-2-phenylspiro[3a,5,6,6a-tetrahydrocyclopenta[c]pyrrole-4,5'-imidazole]-1,3,4'-trione |
|---|---|
| PubChem CID | 134864352 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | (4R)-3'-benzyl-2-phenylspiro[3a,5,6,6a-tetrahydrocyclopenta[c]pyrrole-4,5'-imidazole]-1,3,4'-trione |
| SMILES | O=C1C2CC[C@@]3(N=CN(Cc4ccccc4)C3=O)C2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C22H19N3O3/c26-19-17-11-12-22(18(17)20(27)25(19)16-9-5-2-6-10-16)21(28)24(14-23-22)13-15-7-3-1-4-8-15/h1-10,14,17-18H,11-13H2/t17?,18?,22-/m1/s1 |
| InChIKey | BLIPTRAEQPLRCH-RWWKDMOOSA-N |
| XLogP | 2.40 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|