C11H11NOS — CID 134864394
5-anilino-2,3-dihydrothiopyran-4-one (PubChem CID 134864394) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 5-anilino-2,3-dihydrothiopyran-4-one.
| Compound Name | 5-anilino-2,3-dihydrothiopyran-4-one |
|---|---|
| PubChem CID | 134864394 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 5-anilino-2,3-dihydrothiopyran-4-one |
| SMILES | O=C1CCSC=C1Nc1ccccc1 |
| InChI | InChI=1S/C11H11NOS/c13-11-6-7-14-8-10(11)12-9-4-2-1-3-5-9/h1-5,8,12H,6-7H2 |
| InChIKey | FZQDBCUJHGZWES-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |