C32H51IO6 — CID 134864395
[(3Z,5S,6S,7S,8R,11S,13S,14R,15S,16Z)-8,14-dihydroxy-17-iodo-5,7,11,13,15-pentamethylheptadeca-1,3,16-trien-6-yl] (2Z,4E,6R,7S)-7-hydroxy-6-methyl-9-oxonona-2,4-dienoate (PubChem CID 134864395) has the molecular formula C32H51IO6 and a molecular weight of 658.66 g/mol. Its IUPAC name is [(3Z,5S,6S,7S,8R,11S,13S,14R,15S,16Z)-8,14-dihydroxy-17-iodo-5,7,11,13,15-pentamethylheptadeca-1,3,16-trien-6-yl] (2Z,4E,6R,7S)-7-hydroxy-6-methyl-9-oxonona-2,4-dienoate.
| Compound Name | [(3Z,5S,6S,7S,8R,11S,13S,14R,15S,16Z)-8,14-dihydroxy-17-iodo-5,7,11,13,15-pentamethylheptadeca-1,3,16-trien-6-yl] (2Z,4E,6R,7S)-7-hydroxy-6-methyl-9-oxonona-2,4-dienoate |
|---|---|
| PubChem CID | 134864395 |
| Molecular Formula | C32H51IO6 |
| Molecular Weight | 658.66 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | [(3Z,5S,6S,7S,8R,11S,13S,14R,15S,16Z)-8,14-dihydroxy-17-iodo-5,7,11,13,15-pentamethylheptadeca-1,3,16-trien-6-yl] (2Z,4E,6R,7S)-7-hydroxy-6-methyl-9-oxonona-2,4-dienoate |
| SMILES | C=C/C=C\[C@H](C)[C@H](OC(=O)/C=C\C=C\[C@@H](C)[C@@H](O)CC=O)[C@@H](C)[C@H](O)CC[C@H](C)C[C@H](C)[C@@H](O)[C@@H](C)/C=C\I |
| InChI | InChI=1S/C32H51IO6/c1-8-9-12-25(5)32(39-30(37)14-11-10-13-23(3)28(35)18-20-34)27(7)29(36)16-15-22(2)21-26(6)31(38)24(4)17-19-33/h8-14,17,19-20,22-29,31-32,35-36,38H,1,15-16,18,21H2,2-7H3/b12-9-,13-10+,14-11-,19-17-/t22-,23+,24-,25-,26-,27-,28-,29+,31-,32-/m0/s1 |
| InChIKey | ZWZCZSZJITVGCA-HDUVYDISSA-N |
| XLogP | 6.36 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|