C26H24O6S — CID 134864478
[(6S,8aS)-7-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate (PubChem CID 134864478) has the molecular formula C26H24O6S and a molecular weight of 464.54 g/mol. Its IUPAC name is [(6S,8aS)-7-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate.
| Compound Name | [(6S,8aS)-7-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
|---|---|
| PubChem CID | 134864478 |
| Molecular Formula | C26H24O6S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [(6S,8aS)-7-hydroxy-2-phenyl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] benzoate |
| SMILES | O=C(OC1C(O)[C@H](Sc2ccccc2)OC2COC(c3ccccc3)O[C@@H]21)c1ccccc1 |
| InChI | InChI=1S/C26H24O6S/c27-21-23(31-24(28)17-10-4-1-5-11-17)22-20(30-26(21)33-19-14-8-3-9-15-19)16-29-25(32-22)18-12-6-2-7-13-18/h1-15,20-23,25-27H,16H2/t20?,21?,22-,23?,25?,26-/m0/s1 |
| InChIKey | GVVABPBINXKKBE-YWXISDLXSA-N |
| XLogP | 4.20 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |