About [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate
[5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate (PubChem CID 134864489) has the molecular formula C20H29NO10
and a molecular weight of 443.45 g/mol. Its IUPAC name is [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate |
| PubChem CID | 134864489 |
| Molecular Formula | C20H29NO10 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate |
| SMILES | C=CCC(OC(C)=O)C1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O |
| InChI | InChI=1S/C20H29NO10/c1-7-8-15(28-12(4)24)18-17(21-10(2)22)20(30-14(6)26)19(29-13(5)25)16(31-18)9-27-11(3)23/h7,15-20H,1,8-9H2,2-6H3,(H,21,22) |
| InChIKey | YDYZPHGFTXVVNB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate?
The IUPAC name of [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate (CID 134864489) is [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate.
What is the SMILES notation for [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate?
The canonical SMILES for [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate is C=CCC(OC(C)=O)C1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1NC(C)=O.
What is the InChIKey of [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate?
The InChIKey is YDYZPHGFTXVVNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NO10/c1-7-8-15(28-12(4)24)18-17(21-10(2)22)20(30-14(6)26)19(29-13(5)25)16(31-18)9-27-11(3)23/h7,15-20H,1,8-9H2,2-6H3,(H,21,22).
What are the key properties of [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate?
[5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate has a molecular weight of 443.45 g/mol, XLogP of 0.19, 9 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [5-acetamido-3,4-diacetyloxy-6-(1-acetyloxybut-3-enyl)oxan-2-yl]methyl acetate is sourced from PubChem (CID 134864489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).