C23H24N2O4 — CID 134864541
dimethyl (17E)-5,13-dimethyl-1,9-diazatetracyclo[7.7.3.02,7.010,15]nonadeca-2(7),3,5,10(15),11,13,17-heptaene-17,18-dicarboxylate (PubChem CID 134864541) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is dimethyl (17E)-5,13-dimethyl-1,9-diazatetracyclo[7.7.3.02,7.010,15]nonadeca-2(7),3,5,10(15),11,13,17-heptaene-17,18-dicarboxylate.
| Compound Name | dimethyl (17E)-5,13-dimethyl-1,9-diazatetracyclo[7.7.3.02,7.010,15]nonadeca-2(7),3,5,10(15),11,13,17-heptaene-17,18-dicarboxylate |
|---|---|
| PubChem CID | 134864541 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | dimethyl (17E)-5,13-dimethyl-1,9-diazatetracyclo[7.7.3.02,7.010,15]nonadeca-2(7),3,5,10(15),11,13,17-heptaene-17,18-dicarboxylate |
| SMILES | COC(=O)/C1=C(\C(=O)OC)N2Cc3cc(C)ccc3N(C1)Cc1cc(C)ccc12 |
| InChI | InChI=1S/C23H24N2O4/c1-14-5-7-19-17(10-14)12-25-20-8-6-15(2)9-16(20)11-24(19)13-18(22(26)28-3)21(25)23(27)29-4/h5-10H,11-13H2,1-4H3/b21-18+ |
| InChIKey | BCRXTHQLQYWEMM-DYTRJAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |