C13H23NS2 — CID 134864576
[(1R,2S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl N,N-dimethylcarbamodithioate (PubChem CID 134864576) has the molecular formula C13H23NS2 and a molecular weight of 257.47 g/mol. Its IUPAC name is [(1R,2S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl N,N-dimethylcarbamodithioate.
| Compound Name | [(1R,2S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 134864576 |
| Molecular Formula | C13H23NS2 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [(1R,2S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)SC[C@H]1CC[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C13H23NS2/c1-13(2)10-6-5-9(11(13)7-10)8-16-12(15)14(3)4/h9-11H,5-8H2,1-4H3/t9-,10-,11-/m1/s1 |
| InChIKey | XSULOXATTKQZPU-GMTAPVOTSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|