C25H51IO7Si2 — CID 134864605
tert-butyl-[(S)-[(4S,5R)-2,2-dimethyl-5-(2-trimethylsilylethoxymethoxymethyl)-1,3-dioxolan-4-yl]-[(4R,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane (PubChem CID 134864605) has the molecular formula C25H51IO7Si2 and a molecular weight of 646.75 g/mol. Its IUPAC name is tert-butyl-[(S)-[(4S,5R)-2,2-dimethyl-5-(2-trimethylsilylethoxymethoxymethyl)-1,3-dioxolan-4-yl]-[(4R,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(S)-[(4S,5R)-2,2-dimethyl-5-(2-trimethylsilylethoxymethoxymethyl)-1,3-dioxolan-4-yl]-[(4R,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134864605 |
| Molecular Formula | C25H51IO7Si2 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | tert-butyl-[(S)-[(4S,5R)-2,2-dimethyl-5-(2-trimethylsilylethoxymethoxymethyl)-1,3-dioxolan-4-yl]-[(4R,5S)-5-(iodomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-dimethylsilane |
| SMILES | CC1(C)O[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2CI)[C@@H](COCOCC[Si](C)(C)C)O1 |
| InChI | InChI=1S/C25H51IO7Si2/c1-23(2,3)35(11,12)33-22(20-18(15-26)29-24(4,5)31-20)21-19(30-25(6,7)32-21)16-28-17-27-13-14-34(8,9)10/h18-22H,13-17H2,1-12H3/t18-,19-,20-,21+,22-/m1/s1 |
| InChIKey | FUUPEJJKMNSTNB-CSEOROSGSA-N |
| XLogP | 6.18 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|