About 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol
2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol (PubChem CID 134864617) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol.
Molecular Properties
| Compound Name | 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol |
| PubChem CID | 134864617 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol |
| SMILES | CCC(O)C(C)(C)C(O)n1cccc1 |
| InChI | InChI=1S/C11H19NO2/c1-4-9(13)11(2,3)10(14)12-7-5-6-8-12/h5-10,13-14H,4H2,1-3H3 |
| InChIKey | BNSFDTKAAAOTPW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol?
The IUPAC name of 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol (CID 134864617) is 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol.
What is the SMILES notation for 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol?
The canonical SMILES for 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol is CCC(O)C(C)(C)C(O)n1cccc1.
What is the InChIKey of 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol?
The InChIKey is BNSFDTKAAAOTPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-4-9(13)11(2,3)10(14)12-7-5-6-8-12/h5-10,13-14H,4H2,1-3H3.
What are the key properties of 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol?
2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol has a molecular weight of 197.28 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1-pyrrol-1-ylpentane-1,3-diol is sourced from PubChem (CID 134864617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).