C38H40F2O8 — CID 134864618
ethyl 2,2-difluoro-2-[(2R,3R,5R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate (PubChem CID 134864618) has the molecular formula C38H40F2O8 and a molecular weight of 662.73 g/mol. Its IUPAC name is ethyl 2,2-difluoro-2-[(2R,3R,5R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate.
| Compound Name | ethyl 2,2-difluoro-2-[(2R,3R,5R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 134864618 |
| Molecular Formula | C38H40F2O8 |
| Molecular Weight | 662.73 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | ethyl 2,2-difluoro-2-[(2R,3R,5R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetate |
| SMILES | CCOC(=O)C(F)(F)[C@]1(O)OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H40F2O8/c1-2-44-36(41)37(39,40)38(42)35(47-26-31-21-13-6-14-22-31)34(46-25-30-19-11-5-12-20-30)33(45-24-29-17-9-4-10-18-29)32(48-38)27-43-23-28-15-7-3-8-16-28/h3-22,32-35,42H,2,23-27H2,1H3/t32?,33-,34?,35-,38-/m1/s1 |
| InChIKey | HVGFZEYGNHVSDO-ILEITMQRSA-N |
| XLogP | 6.25 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |