C27H35O6PS — CID 134864636
[(6R)-6-tert-butylsulfanyl-7-diphenylphosphanyloxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate (PubChem CID 134864636) has the molecular formula C27H35O6PS and a molecular weight of 518.61 g/mol. Its IUPAC name is [(6R)-6-tert-butylsulfanyl-7-diphenylphosphanyloxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate.
| Compound Name | [(6R)-6-tert-butylsulfanyl-7-diphenylphosphanyloxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate |
|---|---|
| PubChem CID | 134864636 |
| Molecular Formula | C27H35O6PS |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | [(6R)-6-tert-butylsulfanyl-7-diphenylphosphanyloxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@H](SC(C)(C)C)C(OP(c2ccccc2)c2ccccc2)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C27H35O6PS/c1-18(28)29-17-21-22-23(32-27(5,6)31-22)24(25(30-21)35-26(2,3)4)33-34(19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21-25H,17H2,1-6H3/t21?,22?,23?,24?,25-/m1/s1 |
| InChIKey | DLGJHKOAOSSFTC-VJHMRKFVSA-N |
| XLogP | 4.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|