About (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium
(2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium (PubChem CID 134864639) has the molecular formula C7H9O2Y-
and a molecular weight of 214.05 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium.
Molecular Properties
| Compound Name | (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium |
| PubChem CID | 134864639 |
| Molecular Formula | C7H9O2Y- |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium |
| SMILES | [C-]#C[C@H](C)[C@@H](C)C(=O)O.[Y] |
| InChI | InChI=1S/C7H9O2.Y/c1-4-5(2)6(3)7(8)9;/h5-6H,2-3H3,(H,8,9);/q-1;/t5-,6+;/m0./s1 |
| InChIKey | BPQNLFJJTXUOND-RIHPBJNCSA-N |
| XLogP | 0.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium?
The IUPAC name of (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium (CID 134864639) is (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium.
What is the SMILES notation for (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium?
The canonical SMILES for (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium is [C-]#C[C@H](C)[C@@H](C)C(=O)O.[Y].
What is the InChIKey of (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium?
The InChIKey is BPQNLFJJTXUOND-RIHPBJNCSA-N. The full InChI is InChI=1S/C7H9O2.Y/c1-4-5(2)6(3)7(8)9;/h5-6H,2-3H3,(H,8,9);/q-1;/t5-,6+;/m0./s1.
What are the key properties of (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium?
(2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium has a molecular weight of 214.05 g/mol, XLogP of 0.93, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2,3-dimethylpent-4-ynoic acid;yttrium is sourced from PubChem (CID 134864639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).