C25H36O6 — CID 134864657
ethyl (3R,4aS,5S,6S)-3-ethoxy-8-[(2E,7E)-9-methoxy-9-oxonona-2,7-dien-2-yl]-5-methyl-4,4a,5,6-tetrahydro-3H-isochromene-6-carboxylate (PubChem CID 134864657) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is ethyl (3R,4aS,5S,6S)-3-ethoxy-8-[(2E,7E)-9-methoxy-9-oxonona-2,7-dien-2-yl]-5-methyl-4,4a,5,6-tetrahydro-3H-isochromene-6-carboxylate.
| Compound Name | ethyl (3R,4aS,5S,6S)-3-ethoxy-8-[(2E,7E)-9-methoxy-9-oxonona-2,7-dien-2-yl]-5-methyl-4,4a,5,6-tetrahydro-3H-isochromene-6-carboxylate |
|---|---|
| PubChem CID | 134864657 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | ethyl (3R,4aS,5S,6S)-3-ethoxy-8-[(2E,7E)-9-methoxy-9-oxonona-2,7-dien-2-yl]-5-methyl-4,4a,5,6-tetrahydro-3H-isochromene-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C=C(/C(C)=C/CCC/C=C/C(=O)OC)C2=CO[C@@H](OCC)C[C@H]2[C@@H]1C |
| InChI | InChI=1S/C25H36O6/c1-6-29-24-15-20-18(4)21(25(27)30-7-2)14-19(22(20)16-31-24)17(3)12-10-8-9-11-13-23(26)28-5/h11-14,16,18,20-21,24H,6-10,15H2,1-5H3/b13-11+,17-12+/t18-,20-,21+,24+/m0/s1 |
| InChIKey | VNYZXNQYDZFWAT-GNVMAKERSA-N |
| XLogP | 4.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|