C47H60O3SSi2 — CID 134864716
S-[(5S,9E)-1-[tert-butyl(diphenyl)silyl]oxy-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylundeca-6,7,9-trien-5-yl] ethanethioate (PubChem CID 134864716) has the molecular formula C47H60O3SSi2 and a molecular weight of 761.23 g/mol. Its IUPAC name is S-[(5S,9E)-1-[tert-butyl(diphenyl)silyl]oxy-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylundeca-6,7,9-trien-5-yl] ethanethioate.
| Compound Name | S-[(5S,9E)-1-[tert-butyl(diphenyl)silyl]oxy-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylundeca-6,7,9-trien-5-yl] ethanethioate |
|---|---|
| PubChem CID | 134864716 |
| Molecular Formula | C47H60O3SSi2 |
| Molecular Weight | 761.23 g/mol |
| Exact Mass | 760.38 |
| IUPAC Name | S-[(5S,9E)-1-[tert-butyl(diphenyl)silyl]oxy-8-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylundeca-6,7,9-trien-5-yl] ethanethioate |
| SMILES | C/C=C/C(=C=C(C)[C@H](CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)SC(C)=O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C47H60O3SSi2/c1-10-25-40(37-50-53(47(7,8)9,43-30-19-13-20-31-43)44-32-21-14-22-33-44)36-38(2)45(51-39(3)48)34-23-24-35-49-52(46(4,5)6,41-26-15-11-16-27-41)42-28-17-12-18-29-42/h10-22,25-33,45H,23-24,34-35,37H2,1-9H3/b25-10+/t36?,45-/m0/s1 |
| InChIKey | IFYFXZVVPAVTCD-FPIPRBBYSA-N |
| XLogP | 10.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.23 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|