C9H16O5 — CID 134864820
(3R,6R)-2-(hydroxymethyl)-6-prop-2-enyloxane-3,4,5-triol (PubChem CID 134864820) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is (3R,6R)-2-(hydroxymethyl)-6-prop-2-enyloxane-3,4,5-triol.
| Compound Name | (3R,6R)-2-(hydroxymethyl)-6-prop-2-enyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 134864820 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (3R,6R)-2-(hydroxymethyl)-6-prop-2-enyloxane-3,4,5-triol |
| SMILES | C=CC[C@H]1OC(CO)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C9H16O5/c1-2-3-5-7(11)9(13)8(12)6(4-10)14-5/h2,5-13H,1,3-4H2/t5-,6?,7?,8+,9?/m1/s1 |
| InChIKey | JDPNGXUXFIFPNG-BBGYCLFUSA-N |
| XLogP | -1.60 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|