C40H42O8 — CID 134864833
methyl 2-oxo-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate (PubChem CID 134864833) has the molecular formula C40H42O8 and a molecular weight of 650.77 g/mol. Its IUPAC name is methyl 2-oxo-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate.
| Compound Name | methyl 2-oxo-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 134864833 |
| Molecular Formula | C40H42O8 |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | methyl 2-oxo-2-[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)-2-prop-2-enyloxan-2-yl]acetate |
| SMILES | C=CC[C@]1(C(=O)C(=O)OC)OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C40H42O8/c1-3-24-40(37(41)39(42)43-2)38(47-28-33-22-14-7-15-23-33)36(46-27-32-20-12-6-13-21-32)35(45-26-31-18-10-5-11-19-31)34(48-40)29-44-25-30-16-8-4-9-17-30/h3-23,34-36,38H,1,24-29H2,2H3/t34?,35-,36?,38?,40-/m1/s1 |
| InChIKey | WFZWWHHAFXOOHV-NDJQLMLESA-N |
| XLogP | 6.42 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|