C40H44O8 — CID 134864834
methyl 2-[(2S,5R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-4-enoate (PubChem CID 134864834) has the molecular formula C40H44O8 and a molecular weight of 652.78 g/mol. Its IUPAC name is methyl 2-[(2S,5R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-4-enoate.
| Compound Name | methyl 2-[(2S,5R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 134864834 |
| Molecular Formula | C40H44O8 |
| Molecular Weight | 652.78 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | methyl 2-[(2S,5R)-2-hydroxy-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-4-enoate |
| SMILES | C=CCC(C(=O)OC)[C@]1(O)OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C40H44O8/c1-3-16-34(39(41)43-2)40(42)38(47-28-33-23-14-7-15-24-33)37(46-27-32-21-12-6-13-22-32)36(45-26-31-19-10-5-11-20-31)35(48-40)29-44-25-30-17-8-4-9-18-30/h3-15,17-24,34-38,42H,1,16,25-29H2,2H3/t34?,35?,36-,37?,38?,40+/m1/s1 |
| InChIKey | HTCKAPXFFPNERV-ZMAKTAJVSA-N |
| XLogP | 6.41 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.78 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|