C27H37NO5Si — CID 134864863
benzyl (2R,3R)-2-(benzoyloxymethyl)-3-methyl-3-triethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 134864863) has the molecular formula C27H37NO5Si and a molecular weight of 483.68 g/mol. Its IUPAC name is benzyl (2R,3R)-2-(benzoyloxymethyl)-3-methyl-3-triethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3R)-2-(benzoyloxymethyl)-3-methyl-3-triethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134864863 |
| Molecular Formula | C27H37NO5Si |
| Molecular Weight | 483.68 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | benzyl (2R,3R)-2-(benzoyloxymethyl)-3-methyl-3-triethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CCN(C(=O)OCc2ccccc2)[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H37NO5Si/c1-5-34(6-2,7-3)33-27(4)18-19-28(26(30)32-20-22-14-10-8-11-15-22)24(27)21-31-25(29)23-16-12-9-13-17-23/h8-17,24H,5-7,18-21H2,1-4H3/t24-,27-/m1/s1 |
| InChIKey | FCODRFCPBBISCC-SHQCIBLASA-N |
| XLogP | 6.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|